ChemNet > CAS > 82140-55-4 methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate
82140-55-4 methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate
Ονομασία του προϊόντος |
methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate |
Αγγλικό όνομα |
methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate;methyl (2Z)-2-[(2,6-dichloropyridin-4-yl)carbonyl]-3-(methylamino)but-2-enoate; methyl 2-[(2,6-dichloropyridin-4-yl)carbonyl]-3-(methylamino)but-2-enoate |
MF |
C12H12Cl2N2O3 |
Μοριακό βάρος |
303.1413 |
InChI |
InChI=1/C12H12Cl2N2O3/c1-6(15-2)10(12(18)19-3)11(17)7-4-8(13)16-9(14)5-7/h4-5,15H,1-3H3 |
CAS ΟΧΙ |
82140-55-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.34g/cm3 |
Σημείο τήξης |
112℃ |
Σημείο βρασμού |
462.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.553 |
Σημείο ανάφλεξης |
233.8°C |
Πίεση ατμών |
9.48E-09mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|